About 5-methylidenepyren-4-one
5-methylidenepyren-4-one (PubChem CID 154595995) has the molecular formula C17H10O
and a molecular weight of 230.27 g/mol. Its IUPAC name is 5-methylidenepyren-4-one.
Molecular Properties
| Compound Name | 5-methylidenepyren-4-one |
| PubChem CID | 154595995 |
| Molecular Formula | C17H10O |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 5-methylidenepyren-4-one |
| SMILES | C=C1C(=O)c2cccc3ccc4cccc1c4c23 |
| InChI | InChI=1S/C17H10O/c1-10-13-6-2-4-11-8-9-12-5-3-7-14(17(10)18)16(12)15(11)13/h2-9H,1H2 |
| InChIKey | KFQNNZXGHQXZFY-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 5-methylidenepyren-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylidenepyren-4-one?
The IUPAC name of 5-methylidenepyren-4-one (CID 154595995) is 5-methylidenepyren-4-one.
What is the SMILES notation for 5-methylidenepyren-4-one?
The canonical SMILES for 5-methylidenepyren-4-one is C=C1C(=O)c2cccc3ccc4cccc1c4c23.
What is the InChIKey of 5-methylidenepyren-4-one?
The InChIKey is KFQNNZXGHQXZFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H10O/c1-10-13-6-2-4-11-8-9-12-5-3-7-14(17(10)18)16(12)15(11)13/h2-9H,1H2.
What are the key properties of 5-methylidenepyren-4-one?
5-methylidenepyren-4-one has a molecular weight of 230.27 g/mol, XLogP of 4.20, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylidenepyren-4-one is sourced from PubChem (CID 154595995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).