About 3-nitroacenaphthylene-1,2-dione
3-nitroacenaphthylene-1,2-dione (PubChem CID 71120165) has the molecular formula C12H5NO4
and a molecular weight of 227.18 g/mol. Its IUPAC name is 3-nitroacenaphthylene-1,2-dione.
Molecular Properties
| Compound Name | 3-nitroacenaphthylene-1,2-dione |
| PubChem CID | 71120165 |
| Molecular Formula | C12H5NO4 |
| Molecular Weight | 227.18 g/mol |
| Exact Mass | 227.02 |
| IUPAC Name | 3-nitroacenaphthylene-1,2-dione |
| SMILES | O=C1C(=O)c2c([N+](=O)[O-])ccc3cccc1c23 |
| InChI | InChI=1S/C12H5NO4/c14-11-7-3-1-2-6-4-5-8(13(16)17)10(9(6)7)12(11)15/h1-5H |
| InChIKey | VHWWGPALAQGYDH-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 77.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.18 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-nitroacenaphthylene-1,2-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-nitroacenaphthylene-1,2-dione?
The IUPAC name of 3-nitroacenaphthylene-1,2-dione (CID 71120165) is 3-nitroacenaphthylene-1,2-dione.
What is the SMILES notation for 3-nitroacenaphthylene-1,2-dione?
The canonical SMILES for 3-nitroacenaphthylene-1,2-dione is O=C1C(=O)c2c([N+](=O)[O-])ccc3cccc1c23.
What is the InChIKey of 3-nitroacenaphthylene-1,2-dione?
The InChIKey is VHWWGPALAQGYDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H5NO4/c14-11-7-3-1-2-6-4-5-8(13(16)17)10(9(6)7)12(11)15/h1-5H.
What are the key properties of 3-nitroacenaphthylene-1,2-dione?
3-nitroacenaphthylene-1,2-dione has a molecular weight of 227.18 g/mol, XLogP of 2.13, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-nitroacenaphthylene-1,2-dione is sourced from PubChem (CID 71120165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).