C15H12O2S — CID 151685364
3-propylsulfanylacenaphthylene-1,2-dione (PubChem CID 151685364) has the molecular formula C15H12O2S and a molecular weight of 256.33 g/mol. Its IUPAC name is 3-propylsulfanylacenaphthylene-1,2-dione.
| Compound Name | 3-propylsulfanylacenaphthylene-1,2-dione |
|---|---|
| PubChem CID | 151685364 |
| Molecular Formula | C15H12O2S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | 3-propylsulfanylacenaphthylene-1,2-dione |
| SMILES | CCCSc1ccc2cccc3c2c1C(=O)C3=O |
| InChI | InChI=1S/C15H12O2S/c1-2-8-18-11-7-6-9-4-3-5-10-12(9)13(11)15(17)14(10)16/h3-7H,2,8H2,1H3 |
| InChIKey | RBKQEJOBYAPQRU-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|