C18H16O3S — CID 18970642
1-butylsulfanyl-4-hydroxyanthracene-9,10-dione (PubChem CID 18970642) has the molecular formula C18H16O3S and a molecular weight of 312.39 g/mol. Its IUPAC name is 1-butylsulfanyl-4-hydroxyanthracene-9,10-dione.
| Compound Name | 1-butylsulfanyl-4-hydroxyanthracene-9,10-dione |
|---|---|
| PubChem CID | 18970642 |
| Molecular Formula | C18H16O3S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | 1-butylsulfanyl-4-hydroxyanthracene-9,10-dione |
| SMILES | CCCCSc1ccc(O)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C18H16O3S/c1-2-3-10-22-14-9-8-13(19)15-16(14)18(21)12-7-5-4-6-11(12)17(15)20/h4-9,19H,2-3,10H2,1H3 |
| InChIKey | PLZOAKHFVYJVCM-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|