C17H20O2S — CID 57411027
2-heptylsulfanylnaphthalene-1,4-dione (PubChem CID 57411027) has the molecular formula C17H20O2S and a molecular weight of 288.41 g/mol. Its IUPAC name is 2-heptylsulfanylnaphthalene-1,4-dione.
| Compound Name | 2-heptylsulfanylnaphthalene-1,4-dione |
|---|---|
| PubChem CID | 57411027 |
| Molecular Formula | C17H20O2S |
| Molecular Weight | 288.41 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | 2-heptylsulfanylnaphthalene-1,4-dione |
| SMILES | CCCCCCCSC1=CC(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C17H20O2S/c1-2-3-4-5-8-11-20-16-12-15(18)13-9-6-7-10-14(13)17(16)19/h6-7,9-10,12H,2-5,8,11H2,1H3 |
| InChIKey | KUCKSRCSUFUNKD-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.41 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|