C16H18O2 — CID 14200725
2-hexylnaphthalene-1,4-dione (PubChem CID 14200725) has the molecular formula C16H18O2 and a molecular weight of 242.32 g/mol. Its IUPAC name is 2-hexylnaphthalene-1,4-dione.
| Compound Name | 2-hexylnaphthalene-1,4-dione |
|---|---|
| PubChem CID | 14200725 |
| Molecular Formula | C16H18O2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 2-hexylnaphthalene-1,4-dione |
| SMILES | CCCCCCC1=CC(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C16H18O2/c1-2-3-4-5-8-12-11-15(17)13-9-6-7-10-14(13)16(12)18/h6-7,9-11H,2-5,8H2,1H3 |
| InChIKey | NZTKOQRUPFFWAD-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|