C15H15ClO4S — CID 134558903
5-(1,4-dioxonaphthalen-2-yl)pentane-1-sulfonyl chloride (PubChem CID 134558903) has the molecular formula C15H15ClO4S and a molecular weight of 326.80 g/mol. Its IUPAC name is 5-(1,4-dioxonaphthalen-2-yl)pentane-1-sulfonyl chloride.
| Compound Name | 5-(1,4-dioxonaphthalen-2-yl)pentane-1-sulfonyl chloride |
|---|---|
| PubChem CID | 134558903 |
| Molecular Formula | C15H15ClO4S |
| Molecular Weight | 326.80 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | 5-(1,4-dioxonaphthalen-2-yl)pentane-1-sulfonyl chloride |
| SMILES | O=C1C=C(CCCCCS(=O)(=O)Cl)C(=O)c2ccccc21 |
| InChI | InChI=1S/C15H15ClO4S/c16-21(19,20)9-5-1-2-6-11-10-14(17)12-7-3-4-8-13(12)15(11)18/h3-4,7-8,10H,1-2,5-6,9H2 |
| InChIKey | MGDIEMXVFMONID-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.80 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|