C18H22O5 — CID 159661269
2-[3-[2-(2-methoxyethoxy)ethoxy]propyl]naphthalene-1,4-dione (PubChem CID 159661269) has the molecular formula C18H22O5 and a molecular weight of 318.37 g/mol. Its IUPAC name is 2-[3-[2-(2-methoxyethoxy)ethoxy]propyl]naphthalene-1,4-dione.
| Compound Name | 2-[3-[2-(2-methoxyethoxy)ethoxy]propyl]naphthalene-1,4-dione |
|---|---|
| PubChem CID | 159661269 |
| Molecular Formula | C18H22O5 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 2-[3-[2-(2-methoxyethoxy)ethoxy]propyl]naphthalene-1,4-dione |
| SMILES | COCCOCCOCCCC1=CC(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H22O5/c1-21-9-10-23-12-11-22-8-4-5-14-13-17(19)15-6-2-3-7-16(15)18(14)20/h2-3,6-7,13H,4-5,8-12H2,1H3 |
| InChIKey | UPUPWCNSKRDJIE-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|