C20H18O5 — CID 118258353
2-[(2,3,4-trimethoxyphenyl)methyl]naphthalene-1,4-dione (PubChem CID 118258353) has the molecular formula C20H18O5 and a molecular weight of 338.36 g/mol. Its IUPAC name is 2-[(2,3,4-trimethoxyphenyl)methyl]naphthalene-1,4-dione.
| Compound Name | 2-[(2,3,4-trimethoxyphenyl)methyl]naphthalene-1,4-dione |
|---|---|
| PubChem CID | 118258353 |
| Molecular Formula | C20H18O5 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 2-[(2,3,4-trimethoxyphenyl)methyl]naphthalene-1,4-dione |
| SMILES | COc1ccc(CC2=CC(=O)c3ccccc3C2=O)c(OC)c1OC |
| InChI | InChI=1S/C20H18O5/c1-23-17-9-8-12(19(24-2)20(17)25-3)10-13-11-16(21)14-6-4-5-7-15(14)18(13)22/h4-9,11H,10H2,1-3H3 |
| InChIKey | KWNPRSKKILFDNI-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|