C13H12O5 — CID 71387360
2,7,8-trimethoxynaphthalene-1,4-dione (PubChem CID 71387360) has the molecular formula C13H12O5 and a molecular weight of 248.23 g/mol. Its IUPAC name is 2,7,8-trimethoxynaphthalene-1,4-dione.
| Compound Name | 2,7,8-trimethoxynaphthalene-1,4-dione |
|---|---|
| PubChem CID | 71387360 |
| Molecular Formula | C13H12O5 |
| Molecular Weight | 248.23 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | 2,7,8-trimethoxynaphthalene-1,4-dione |
| SMILES | COC1=CC(=O)c2ccc(OC)c(OC)c2C1=O |
| InChI | InChI=1S/C13H12O5/c1-16-9-5-4-7-8(14)6-10(17-2)12(15)11(7)13(9)18-3/h4-6H,1-3H3 |
| InChIKey | GZAJIZJOYAMDGX-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.23 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|