C11H6Cl2O3 — CID 15029633
5,7-dichloro-2-methoxynaphthalene-1,4-dione (PubChem CID 15029633) has the molecular formula C11H6Cl2O3 and a molecular weight of 257.07 g/mol. Its IUPAC name is 5,7-dichloro-2-methoxynaphthalene-1,4-dione.
| Compound Name | 5,7-dichloro-2-methoxynaphthalene-1,4-dione |
|---|---|
| PubChem CID | 15029633 |
| Molecular Formula | C11H6Cl2O3 |
| Molecular Weight | 257.07 g/mol |
| Exact Mass | 255.97 |
| IUPAC Name | 5,7-dichloro-2-methoxynaphthalene-1,4-dione |
| SMILES | COC1=CC(=O)c2c(Cl)cc(Cl)cc2C1=O |
| InChI | InChI=1S/C11H6Cl2O3/c1-16-9-4-8(14)10-6(11(9)15)2-5(12)3-7(10)13/h2-4H,1H3 |
| InChIKey | TVESNGUSWSBPAB-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.07 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|