C27H24O11 — CID 170989302
4,5-dihydroxy-3-[1-(1-hydroxy-3,6-dimethoxy-5,8-dioxonaphthalen-2-yl)ethyl]-6-(1-hydroxyethyl)-7-methoxynaphthalene-1,2-dione (PubChem CID 170989302) has the molecular formula C27H24O11 and a molecular weight of 524.48 g/mol. Its IUPAC name is 4,5-dihydroxy-3-[1-(1-hydroxy-3,6-dimethoxy-5,8-dioxonaphthalen-2-yl)ethyl]-6-(1-hydroxyethyl)-7-methoxynaphthalene-1,2-dione.
| Compound Name | 4,5-dihydroxy-3-[1-(1-hydroxy-3,6-dimethoxy-5,8-dioxonaphthalen-2-yl)ethyl]-6-(1-hydroxyethyl)-7-methoxynaphthalene-1,2-dione |
|---|---|
| PubChem CID | 170989302 |
| Molecular Formula | C27H24O11 |
| Molecular Weight | 524.48 g/mol |
| Exact Mass | 524.13 |
| IUPAC Name | 4,5-dihydroxy-3-[1-(1-hydroxy-3,6-dimethoxy-5,8-dioxonaphthalen-2-yl)ethyl]-6-(1-hydroxyethyl)-7-methoxynaphthalene-1,2-dione |
| SMILES | COC1=CC(=O)c2c(cc(OC)c(C(C)C3=C(O)c4c(cc(OC)c(C(C)O)c4O)C(=O)C3=O)c2O)C1=O |
| InChI | InChI=1S/C27H24O11/c1-9(17-14(36-3)6-11-20(24(17)32)13(29)8-16(38-5)22(11)30)18-25(33)21-12(23(31)27(18)35)7-15(37-4)19(10(2)28)26(21)34/h6-10,28,32-34H,1-5H3 |
| InChIKey | YOPZGBQOWYFVSF-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 176.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.48 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|