C23H22O6 — CID 11990004
7-[(E)-4-hydroxybut-2-enyl]-6-[hydroxy(phenyl)methyl]-2,5-dimethoxynaphthalene-1,4-dione (PubChem CID 11990004) has the molecular formula C23H22O6 and a molecular weight of 394.42 g/mol. Its IUPAC name is 7-[(E)-4-hydroxybut-2-enyl]-6-[hydroxy(phenyl)methyl]-2,5-dimethoxynaphthalene-1,4-dione.
| Compound Name | 7-[(E)-4-hydroxybut-2-enyl]-6-[hydroxy(phenyl)methyl]-2,5-dimethoxynaphthalene-1,4-dione |
|---|---|
| PubChem CID | 11990004 |
| Molecular Formula | C23H22O6 |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 7-[(E)-4-hydroxybut-2-enyl]-6-[hydroxy(phenyl)methyl]-2,5-dimethoxynaphthalene-1,4-dione |
| SMILES | COC1=CC(=O)c2c(cc(C/C=C/CO)c(C(O)c3ccccc3)c2OC)C1=O |
| InChI | InChI=1S/C23H22O6/c1-28-18-13-17(25)20-16(22(18)27)12-15(10-6-7-11-24)19(23(20)29-2)21(26)14-8-4-3-5-9-14/h3-9,12-13,21,24,26H,10-11H2,1-2H3/b7-6+ |
| InChIKey | WMAFJLWDYGVMCK-VOTSOKGWSA-N |
| XLogP | 2.78 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|