C12H9ClO3 — CID 13412780
2-chloro-5-methoxy-7-methylnaphthalene-1,4-dione (PubChem CID 13412780) has the molecular formula C12H9ClO3 and a molecular weight of 236.65 g/mol. Its IUPAC name is 2-chloro-5-methoxy-7-methylnaphthalene-1,4-dione.
| Compound Name | 2-chloro-5-methoxy-7-methylnaphthalene-1,4-dione |
|---|---|
| PubChem CID | 13412780 |
| Molecular Formula | C12H9ClO3 |
| Molecular Weight | 236.65 g/mol |
| Exact Mass | 236.02 |
| IUPAC Name | 2-chloro-5-methoxy-7-methylnaphthalene-1,4-dione |
| SMILES | COc1cc(C)cc2c1C(=O)C=C(Cl)C2=O |
| InChI | InChI=1S/C12H9ClO3/c1-6-3-7-11(10(4-6)16-2)9(14)5-8(13)12(7)15/h3-5H,1-2H3 |
| InChIKey | FJVDXTUACFXISP-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.65 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|