C15H17NO3 — CID 169250098
2-(2,3-dimethoxy-5-methylphenyl)-6-methyl-1H-pyridin-4-one (PubChem CID 169250098) has the molecular formula C15H17NO3 and a molecular weight of 259.31 g/mol. Its IUPAC name is 2-(2,3-dimethoxy-5-methylphenyl)-6-methyl-1H-pyridin-4-one.
| Compound Name | 2-(2,3-dimethoxy-5-methylphenyl)-6-methyl-1H-pyridin-4-one |
|---|---|
| PubChem CID | 169250098 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 2-(2,3-dimethoxy-5-methylphenyl)-6-methyl-1H-pyridin-4-one |
| SMILES | COc1cc(C)cc(-c2cc(=O)cc(C)[nH]2)c1OC |
| InChI | InChI=1S/C15H17NO3/c1-9-5-12(15(19-4)14(6-9)18-3)13-8-11(17)7-10(2)16-13/h5-8H,1-4H3,(H,16,17) |
| InChIKey | AWYIYLGDZVFNKD-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |