C14H17NO3 — CID 82086470
2-methyl-5-(3,4,5-trimethoxyphenyl)-1H-pyrrole (PubChem CID 82086470) has the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. Its IUPAC name is 2-methyl-5-(3,4,5-trimethoxyphenyl)-1H-pyrrole.
| Compound Name | 2-methyl-5-(3,4,5-trimethoxyphenyl)-1H-pyrrole |
|---|---|
| PubChem CID | 82086470 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 2-methyl-5-(3,4,5-trimethoxyphenyl)-1H-pyrrole |
| SMILES | COc1cc(-c2ccc(C)[nH]2)cc(OC)c1OC |
| InChI | InChI=1S/C14H17NO3/c1-9-5-6-11(15-9)10-7-12(16-2)14(18-4)13(8-10)17-3/h5-8,15H,1-4H3 |
| InChIKey | GADPGEONCPTFEV-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 43.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |