C13H13N3O3 — CID 116879942
5-(3,4,5-trimethoxyphenyl)-1H-imidazole-2-carbonitrile (PubChem CID 116879942) has the molecular formula C13H13N3O3 and a molecular weight of 259.26 g/mol. Its IUPAC name is 5-(3,4,5-trimethoxyphenyl)-1H-imidazole-2-carbonitrile.
| Compound Name | 5-(3,4,5-trimethoxyphenyl)-1H-imidazole-2-carbonitrile |
|---|---|
| PubChem CID | 116879942 |
| Molecular Formula | C13H13N3O3 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 5-(3,4,5-trimethoxyphenyl)-1H-imidazole-2-carbonitrile |
| SMILES | COc1cc(-c2cnc(C#N)[nH]2)cc(OC)c1OC |
| InChI | InChI=1S/C13H13N3O3/c1-17-10-4-8(5-11(18-2)13(10)19-3)9-7-15-12(6-14)16-9/h4-5,7H,1-3H3,(H,15,16) |
| InChIKey | LMIJHEAIFKDCCX-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 80.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |