C20H20N2O5 — CID 142749790
methyl 4-[5-(3,4,5-trimethoxyphenyl)-1H-imidazol-2-yl]benzoate (PubChem CID 142749790) has the molecular formula C20H20N2O5 and a molecular weight of 368.39 g/mol. Its IUPAC name is methyl 4-[5-(3,4,5-trimethoxyphenyl)-1H-imidazol-2-yl]benzoate.
| Compound Name | methyl 4-[5-(3,4,5-trimethoxyphenyl)-1H-imidazol-2-yl]benzoate |
|---|---|
| PubChem CID | 142749790 |
| Molecular Formula | C20H20N2O5 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | methyl 4-[5-(3,4,5-trimethoxyphenyl)-1H-imidazol-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2ncc(-c3cc(OC)c(OC)c(OC)c3)[nH]2)cc1 |
| InChI | InChI=1S/C20H20N2O5/c1-24-16-9-14(10-17(25-2)18(16)26-3)15-11-21-19(22-15)12-5-7-13(8-6-12)20(23)27-4/h5-11H,1-4H3,(H,21,22) |
| InChIKey | ODFRNWBAKAKSOI-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 82.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |