C24H21NO6 — CID 56848500
methyl 4-[2-(3,4,5-trimethoxyphenyl)furo[3,2-b]pyridin-7-yl]benzoate (PubChem CID 56848500) has the molecular formula C24H21NO6 and a molecular weight of 419.43 g/mol. Its IUPAC name is methyl 4-[2-(3,4,5-trimethoxyphenyl)furo[3,2-b]pyridin-7-yl]benzoate.
| Compound Name | methyl 4-[2-(3,4,5-trimethoxyphenyl)furo[3,2-b]pyridin-7-yl]benzoate |
|---|---|
| PubChem CID | 56848500 |
| Molecular Formula | C24H21NO6 |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | methyl 4-[2-(3,4,5-trimethoxyphenyl)furo[3,2-b]pyridin-7-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2ccnc3cc(-c4cc(OC)c(OC)c(OC)c4)oc23)cc1 |
| InChI | InChI=1S/C24H21NO6/c1-27-20-11-16(12-21(28-2)23(20)29-3)19-13-18-22(31-19)17(9-10-25-18)14-5-7-15(8-6-14)24(26)30-4/h5-13H,1-4H3 |
| InChIKey | CZOMSMHHXXKQLI-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 80.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |