C29H24N2O5 — CID 66779357
N-phenyl-4-[2-(3,4,5-trimethoxyphenyl)furo[3,2-b]pyridin-7-yl]benzamide (PubChem CID 66779357) has the molecular formula C29H24N2O5 and a molecular weight of 480.52 g/mol. Its IUPAC name is N-phenyl-4-[2-(3,4,5-trimethoxyphenyl)furo[3,2-b]pyridin-7-yl]benzamide.
| Compound Name | N-phenyl-4-[2-(3,4,5-trimethoxyphenyl)furo[3,2-b]pyridin-7-yl]benzamide |
|---|---|
| PubChem CID | 66779357 |
| Molecular Formula | C29H24N2O5 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | N-phenyl-4-[2-(3,4,5-trimethoxyphenyl)furo[3,2-b]pyridin-7-yl]benzamide |
| SMILES | COc1cc(-c2cc3nccc(-c4ccc(C(=O)Nc5ccccc5)cc4)c3o2)cc(OC)c1OC |
| InChI | InChI=1S/C29H24N2O5/c1-33-25-15-20(16-26(34-2)28(25)35-3)24-17-23-27(36-24)22(13-14-30-23)18-9-11-19(12-10-18)29(32)31-21-7-5-4-6-8-21/h4-17H,1-3H3,(H,31,32) |
| InChIKey | PXOWDPQKEHQXIV-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 82.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |