C22H17NO3 — CID 66779782
methyl 3-methyl-5-(7-phenylfuro[3,2-b]pyridin-2-yl)benzoate (PubChem CID 66779782) has the molecular formula C22H17NO3 and a molecular weight of 343.38 g/mol. Its IUPAC name is methyl 3-methyl-5-(7-phenylfuro[3,2-b]pyridin-2-yl)benzoate.
| Compound Name | methyl 3-methyl-5-(7-phenylfuro[3,2-b]pyridin-2-yl)benzoate |
|---|---|
| PubChem CID | 66779782 |
| Molecular Formula | C22H17NO3 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | methyl 3-methyl-5-(7-phenylfuro[3,2-b]pyridin-2-yl)benzoate |
| SMILES | COC(=O)c1cc(C)cc(-c2cc3nccc(-c4ccccc4)c3o2)c1 |
| InChI | InChI=1S/C22H17NO3/c1-14-10-16(12-17(11-14)22(24)25-2)20-13-19-21(26-20)18(8-9-23-19)15-6-4-3-5-7-15/h3-13H,1-2H3 |
| InChIKey | HAQCEGBMPBRAEE-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |