C22H19N3O8 — CID 174691844
nitrous acid;5-[2-(3,4,5-trimethoxyphenyl)furo[3,2-b]pyridin-7-yl]pyridine-3-carboxylic acid (PubChem CID 174691844) has the molecular formula C22H19N3O8 and a molecular weight of 453.41 g/mol. Its IUPAC name is nitrous acid;5-[2-(3,4,5-trimethoxyphenyl)furo[3,2-b]pyridin-7-yl]pyridine-3-carboxylic acid.
| Compound Name | nitrous acid;5-[2-(3,4,5-trimethoxyphenyl)furo[3,2-b]pyridin-7-yl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 174691844 |
| Molecular Formula | C22H19N3O8 |
| Molecular Weight | 453.41 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | nitrous acid;5-[2-(3,4,5-trimethoxyphenyl)furo[3,2-b]pyridin-7-yl]pyridine-3-carboxylic acid |
| SMILES | COc1cc(-c2cc3nccc(-c4cncc(C(=O)O)c4)c3o2)cc(OC)c1OC.O=NO |
| InChI | InChI=1S/C22H18N2O6.HNO2/c1-27-18-7-12(8-19(28-2)21(18)29-3)17-9-16-20(30-17)15(4-5-24-16)13-6-14(22(25)26)11-23-10-13;2-1-3/h4-11H,1-3H3,(H,25,26);(H,2,3) |
| InChIKey | DYCPKNHNGPJWBN-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 153.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.41 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|