C25H20N2O4 — CID 66779212
7-quinolin-6-yl-2-(3,4,5-trimethoxyphenyl)furo[3,2-b]pyridine (PubChem CID 66779212) has the molecular formula C25H20N2O4 and a molecular weight of 412.45 g/mol. Its IUPAC name is 7-quinolin-6-yl-2-(3,4,5-trimethoxyphenyl)furo[3,2-b]pyridine.
| Compound Name | 7-quinolin-6-yl-2-(3,4,5-trimethoxyphenyl)furo[3,2-b]pyridine |
|---|---|
| PubChem CID | 66779212 |
| Molecular Formula | C25H20N2O4 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | 7-quinolin-6-yl-2-(3,4,5-trimethoxyphenyl)furo[3,2-b]pyridine |
| SMILES | COc1cc(-c2cc3nccc(-c4ccc5ncccc5c4)c3o2)cc(OC)c1OC |
| InChI | InChI=1S/C25H20N2O4/c1-28-22-12-17(13-23(29-2)25(22)30-3)21-14-20-24(31-21)18(8-10-27-20)15-6-7-19-16(11-15)5-4-9-26-19/h4-14H,1-3H3 |
| InChIKey | VEUJVNTYNSCVOU-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 66.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |