C25H25NO7 — CID 66779394
2,7-bis(2,3,4-trimethoxyphenyl)furo[3,2-b]pyridine (PubChem CID 66779394) has the molecular formula C25H25NO7 and a molecular weight of 451.48 g/mol. Its IUPAC name is 2,7-bis(2,3,4-trimethoxyphenyl)furo[3,2-b]pyridine.
| Compound Name | 2,7-bis(2,3,4-trimethoxyphenyl)furo[3,2-b]pyridine |
|---|---|
| PubChem CID | 66779394 |
| Molecular Formula | C25H25NO7 |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | 2,7-bis(2,3,4-trimethoxyphenyl)furo[3,2-b]pyridine |
| SMILES | COc1ccc(-c2cc3nccc(-c4ccc(OC)c(OC)c4OC)c3o2)c(OC)c1OC |
| InChI | InChI=1S/C25H25NO7/c1-27-18-9-7-14(22(29-3)24(18)31-5)15-11-12-26-17-13-20(33-21(15)17)16-8-10-19(28-2)25(32-6)23(16)30-4/h7-13H,1-6H3 |
| InChIKey | IKOLDBCBWKXZFA-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 81.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |