C21H21N3O3 — CID 175429008
1-methyl-6-[5-(3,4,5-trimethoxyphenyl)-1H-imidazol-2-yl]indole (PubChem CID 175429008) has the molecular formula C21H21N3O3 and a molecular weight of 363.42 g/mol. Its IUPAC name is 1-methyl-6-[5-(3,4,5-trimethoxyphenyl)-1H-imidazol-2-yl]indole.
| Compound Name | 1-methyl-6-[5-(3,4,5-trimethoxyphenyl)-1H-imidazol-2-yl]indole |
|---|---|
| PubChem CID | 175429008 |
| Molecular Formula | C21H21N3O3 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 1-methyl-6-[5-(3,4,5-trimethoxyphenyl)-1H-imidazol-2-yl]indole |
| SMILES | COc1cc(-c2cnc(-c3ccc4ccn(C)c4c3)[nH]2)cc(OC)c1OC |
| InChI | InChI=1S/C21H21N3O3/c1-24-8-7-13-5-6-14(9-17(13)24)21-22-12-16(23-21)15-10-18(25-2)20(27-4)19(11-15)26-3/h5-12H,1-4H3,(H,22,23) |
| InChIKey | ZHOGCSVLOHFFJY-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 61.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |