About 1-methyl-6-[5-(3,4,5-trimethoxyphenyl)-1H-imidazol-2-yl]indole
1-methyl-6-[5-(3,4,5-trimethoxyphenyl)-1H-imidazol-2-yl]indole (PubChem CID 175429008) has the molecular formula C21H21N3O3
and a molecular weight of 363.42 g/mol. Its IUPAC name is 1-methyl-6-[5-(3,4,5-trimethoxyphenyl)-1H-imidazol-2-yl]indole.
Molecular Properties
| Compound Name | 1-methyl-6-[5-(3,4,5-trimethoxyphenyl)-1H-imidazol-2-yl]indole |
| PubChem CID | 175429008 |
| Molecular Formula | C21H21N3O3 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 1-methyl-6-[5-(3,4,5-trimethoxyphenyl)-1H-imidazol-2-yl]indole |
| SMILES | COc1cc(-c2cnc(-c3ccc4ccn(C)c4c3)[nH]2)cc(OC)c1OC |
| InChI | InChI=1S/C21H21N3O3/c1-24-8-7-13-5-6-14(9-17(13)24)21-22-12-16(23-21)15-10-18(25-2)20(27-4)19(11-15)26-3/h5-12H,1-4H3,(H,22,23) |
| InChIKey | ZHOGCSVLOHFFJY-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 61.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-methyl-6-[5-(3,4,5-trimethoxyphenyl)-1H-imidazol-2-yl]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-6-[5-(3,4,5-trimethoxyphenyl)-1H-imidazol-2-yl]indole?
The IUPAC name of 1-methyl-6-[5-(3,4,5-trimethoxyphenyl)-1H-imidazol-2-yl]indole (CID 175429008) is 1-methyl-6-[5-(3,4,5-trimethoxyphenyl)-1H-imidazol-2-yl]indole.
What is the SMILES notation for 1-methyl-6-[5-(3,4,5-trimethoxyphenyl)-1H-imidazol-2-yl]indole?
The canonical SMILES for 1-methyl-6-[5-(3,4,5-trimethoxyphenyl)-1H-imidazol-2-yl]indole is COc1cc(-c2cnc(-c3ccc4ccn(C)c4c3)[nH]2)cc(OC)c1OC.
What is the InChIKey of 1-methyl-6-[5-(3,4,5-trimethoxyphenyl)-1H-imidazol-2-yl]indole?
The InChIKey is ZHOGCSVLOHFFJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21N3O3/c1-24-8-7-13-5-6-14(9-17(13)24)21-22-12-16(23-21)15-10-18(25-2)20(27-4)19(11-15)26-3/h5-12H,1-4H3,(H,22,23).
What are the key properties of 1-methyl-6-[5-(3,4,5-trimethoxyphenyl)-1H-imidazol-2-yl]indole?
1-methyl-6-[5-(3,4,5-trimethoxyphenyl)-1H-imidazol-2-yl]indole has a molecular weight of 363.42 g/mol, XLogP of 4.26, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-6-[5-(3,4,5-trimethoxyphenyl)-1H-imidazol-2-yl]indole is sourced from PubChem (CID 175429008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).