C21H20N2O4 — CID 10937379
5-(1-methylindol-6-yl)-4-(3,4,5-trimethoxyphenyl)-1,3-oxazole (PubChem CID 10937379) has the molecular formula C21H20N2O4 and a molecular weight of 364.40 g/mol. Its IUPAC name is 5-(1-methylindol-6-yl)-4-(3,4,5-trimethoxyphenyl)-1,3-oxazole.
| Compound Name | 5-(1-methylindol-6-yl)-4-(3,4,5-trimethoxyphenyl)-1,3-oxazole |
|---|---|
| PubChem CID | 10937379 |
| Molecular Formula | C21H20N2O4 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 5-(1-methylindol-6-yl)-4-(3,4,5-trimethoxyphenyl)-1,3-oxazole |
| SMILES | COc1cc(-c2ncoc2-c2ccc3ccn(C)c3c2)cc(OC)c1OC |
| InChI | InChI=1S/C21H20N2O4/c1-23-8-7-13-5-6-14(9-16(13)23)20-19(22-12-27-20)15-10-17(24-2)21(26-4)18(11-15)25-3/h5-12H,1-4H3 |
| InChIKey | ULACDIBWFAOBML-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 58.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|