C18H19N3O4 — CID 118373092
4-[5-(3-amino-4-methoxyphenyl)-1,3-oxazol-4-yl]-2,6-dimethoxyaniline (PubChem CID 118373092) has the molecular formula C18H19N3O4 and a molecular weight of 341.37 g/mol. Its IUPAC name is 4-[5-(3-amino-4-methoxyphenyl)-1,3-oxazol-4-yl]-2,6-dimethoxyaniline.
| Compound Name | 4-[5-(3-amino-4-methoxyphenyl)-1,3-oxazol-4-yl]-2,6-dimethoxyaniline |
|---|---|
| PubChem CID | 118373092 |
| Molecular Formula | C18H19N3O4 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 4-[5-(3-amino-4-methoxyphenyl)-1,3-oxazol-4-yl]-2,6-dimethoxyaniline |
| SMILES | COc1ccc(-c2ocnc2-c2cc(OC)c(N)c(OC)c2)cc1N |
| InChI | InChI=1S/C18H19N3O4/c1-22-13-5-4-10(6-12(13)19)18-17(21-9-25-18)11-7-14(23-2)16(20)15(8-11)24-3/h4-9H,19-20H2,1-3H3 |
| InChIKey | HGWPXQYKYQWBDX-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|