C12H15NO3 — CID 141308126
5,6,7-trimethoxy-1-methylindole (PubChem CID 141308126) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is 5,6,7-trimethoxy-1-methylindole.
| Compound Name | 5,6,7-trimethoxy-1-methylindole |
|---|---|
| PubChem CID | 141308126 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | 5,6,7-trimethoxy-1-methylindole |
| SMILES | COc1cc2ccn(C)c2c(OC)c1OC |
| InChI | InChI=1S/C12H15NO3/c1-13-6-5-8-7-9(14-2)11(15-3)12(16-4)10(8)13/h5-7H,1-4H3 |
| InChIKey | VMPBSPOMPGPPNS-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 32.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |