C13H14ClNO4 — CID 10802949
5,6,7-trimethoxy-1-methylindole-2-carbonyl chloride (PubChem CID 10802949) has the molecular formula C13H14ClNO4 and a molecular weight of 283.71 g/mol. Its IUPAC name is 5,6,7-trimethoxy-1-methylindole-2-carbonyl chloride.
| Compound Name | 5,6,7-trimethoxy-1-methylindole-2-carbonyl chloride |
|---|---|
| PubChem CID | 10802949 |
| Molecular Formula | C13H14ClNO4 |
| Molecular Weight | 283.71 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 5,6,7-trimethoxy-1-methylindole-2-carbonyl chloride |
| SMILES | COc1cc2cc(C(=O)Cl)n(C)c2c(OC)c1OC |
| InChI | InChI=1S/C13H14ClNO4/c1-15-8(13(14)16)5-7-6-9(17-2)11(18-3)12(19-4)10(7)15/h5-6H,1-4H3 |
| InChIKey | CDHRESUACNKAEK-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.71 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|