C21H21NO7 — CID 11234949
1-O-benzyl 2-O-methyl 5,6,7-trimethoxyindole-1,2-dicarboxylate (PubChem CID 11234949) has the molecular formula C21H21NO7 and a molecular weight of 399.40 g/mol. Its IUPAC name is 1-O-benzyl 2-O-methyl 5,6,7-trimethoxyindole-1,2-dicarboxylate.
| Compound Name | 1-O-benzyl 2-O-methyl 5,6,7-trimethoxyindole-1,2-dicarboxylate |
|---|---|
| PubChem CID | 11234949 |
| Molecular Formula | C21H21NO7 |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 1-O-benzyl 2-O-methyl 5,6,7-trimethoxyindole-1,2-dicarboxylate |
| SMILES | COC(=O)c1cc2cc(OC)c(OC)c(OC)c2n1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H21NO7/c1-25-16-11-14-10-15(20(23)28-4)22(17(14)19(27-3)18(16)26-2)21(24)29-12-13-8-6-5-7-9-13/h5-11H,12H2,1-4H3 |
| InChIKey | VCMIVIHCGQUFQB-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 85.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |