C15H13Cl2N3O7 — CID 140938435
6-(2,3,4,5-tetramethoxyphenoxy)-1,3,5-triazine-2,4-dicarbonyl chloride (PubChem CID 140938435) has the molecular formula C15H13Cl2N3O7 and a molecular weight of 418.19 g/mol. Its IUPAC name is 6-(2,3,4,5-tetramethoxyphenoxy)-1,3,5-triazine-2,4-dicarbonyl chloride.
| Compound Name | 6-(2,3,4,5-tetramethoxyphenoxy)-1,3,5-triazine-2,4-dicarbonyl chloride |
|---|---|
| PubChem CID | 140938435 |
| Molecular Formula | C15H13Cl2N3O7 |
| Molecular Weight | 418.19 g/mol |
| Exact Mass | 417.01 |
| IUPAC Name | 6-(2,3,4,5-tetramethoxyphenoxy)-1,3,5-triazine-2,4-dicarbonyl chloride |
| SMILES | COc1cc(Oc2nc(C(=O)Cl)nc(C(=O)Cl)n2)c(OC)c(OC)c1OC |
| InChI | InChI=1S/C15H13Cl2N3O7/c1-23-6-5-7(9(25-3)10(26-4)8(6)24-2)27-15-19-13(11(16)21)18-14(20-15)12(17)22/h5H,1-4H3 |
| InChIKey | IDPHJEAEYUSFRZ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 118.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.19 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|