1,3-dimethoxynaphthalene-2-carbonyl chloride

C13H11ClO3 — CID 21275659

IUPAC1,3-dimethoxynaphthalene-2-carbonyl chloride
SMILESCOc1cc2ccccc2c(OC)c1C(=O)Cl
InChIInChI=1S/C13H11ClO3/c1-16-10-7-8-5-3-4-6-9(8)12(17-2)11(10)13(14)15/h3-7H,1-2H3
InChIKeyNOFYMFUADMTJKX-UHFFFAOYSA-N
MW250.68 g/mol
LogP3.24
Rot. Bonds3

About 1,3-dimethoxynaphthalene-2-carbonyl chloride

1,3-dimethoxynaphthalene-2-carbonyl chloride (PubChem CID 21275659) has the molecular formula C13H11ClO3 and a molecular weight of 250.68 g/mol. Its IUPAC name is 1,3-dimethoxynaphthalene-2-carbonyl chloride.

Molecular Properties

Compound Name1,3-dimethoxynaphthalene-2-carbonyl chloride
PubChem CID21275659
Molecular FormulaC13H11ClO3
Molecular Weight250.68 g/mol
Exact Mass250.04
IUPAC Name1,3-dimethoxynaphthalene-2-carbonyl chloride
SMILESCOc1cc2ccccc2c(OC)c1C(=O)Cl
InChIInChI=1S/C13H11ClO3/c1-16-10-7-8-5-3-4-6-9(8)12(17-2)11(10)13(14)15/h3-7H,1-2H3
InChIKeyNOFYMFUADMTJKX-UHFFFAOYSA-N
XLogP3.24
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500250.68
LogP ≤ 53.24
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 1,3-dimethoxynaphthalene-2-carbonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,3-dimethoxynaphthalene-2-carbonyl chloride?
The IUPAC name of 1,3-dimethoxynaphthalene-2-carbonyl chloride (CID 21275659) is 1,3-dimethoxynaphthalene-2-carbonyl chloride.
What is the SMILES notation for 1,3-dimethoxynaphthalene-2-carbonyl chloride?
The canonical SMILES for 1,3-dimethoxynaphthalene-2-carbonyl chloride is COc1cc2ccccc2c(OC)c1C(=O)Cl.
What is the InChIKey of 1,3-dimethoxynaphthalene-2-carbonyl chloride?
The InChIKey is NOFYMFUADMTJKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11ClO3/c1-16-10-7-8-5-3-4-6-9(8)12(17-2)11(10)13(14)15/h3-7H,1-2H3.
What are the key properties of 1,3-dimethoxynaphthalene-2-carbonyl chloride?
1,3-dimethoxynaphthalene-2-carbonyl chloride has a molecular weight of 250.68 g/mol, XLogP of 3.24, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethoxynaphthalene-2-carbonyl chloride is sourced from PubChem (CID 21275659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).