About (2,3-dimethoxynaphthalen-1-yl) 2-acetyloxypropanoate
(2,3-dimethoxynaphthalen-1-yl) 2-acetyloxypropanoate (PubChem CID 70442854) has the molecular formula C17H18O6
and a molecular weight of 318.33 g/mol. Its IUPAC name is (2,3-dimethoxynaphthalen-1-yl) 2-acetyloxypropanoate.
Molecular Properties
| Compound Name | (2,3-dimethoxynaphthalen-1-yl) 2-acetyloxypropanoate |
| PubChem CID | 70442854 |
| Molecular Formula | C17H18O6 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | (2,3-dimethoxynaphthalen-1-yl) 2-acetyloxypropanoate |
| SMILES | COc1cc2ccccc2c(OC(=O)C(C)OC(C)=O)c1OC |
| InChI | InChI=1S/C17H18O6/c1-10(22-11(2)18)17(19)23-15-13-8-6-5-7-12(13)9-14(20-3)16(15)21-4/h5-10H,1-4H3 |
| InChIKey | NCKGESXBMFWSHR-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2,3-dimethoxynaphthalen-1-yl) 2-acetyloxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,3-dimethoxynaphthalen-1-yl) 2-acetyloxypropanoate?
The IUPAC name of (2,3-dimethoxynaphthalen-1-yl) 2-acetyloxypropanoate (CID 70442854) is (2,3-dimethoxynaphthalen-1-yl) 2-acetyloxypropanoate.
What is the SMILES notation for (2,3-dimethoxynaphthalen-1-yl) 2-acetyloxypropanoate?
The canonical SMILES for (2,3-dimethoxynaphthalen-1-yl) 2-acetyloxypropanoate is COc1cc2ccccc2c(OC(=O)C(C)OC(C)=O)c1OC.
What is the InChIKey of (2,3-dimethoxynaphthalen-1-yl) 2-acetyloxypropanoate?
The InChIKey is NCKGESXBMFWSHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18O6/c1-10(22-11(2)18)17(19)23-15-13-8-6-5-7-12(13)9-14(20-3)16(15)21-4/h5-10H,1-4H3.
What are the key properties of (2,3-dimethoxynaphthalen-1-yl) 2-acetyloxypropanoate?
(2,3-dimethoxynaphthalen-1-yl) 2-acetyloxypropanoate has a molecular weight of 318.33 g/mol, XLogP of 2.71, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2,3-dimethoxynaphthalen-1-yl) 2-acetyloxypropanoate is sourced from PubChem (CID 70442854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).