C13H11ClO — CID 54124479
1,3-dimethylnaphthalene-2-carbonyl chloride (PubChem CID 54124479) has the molecular formula C13H11ClO and a molecular weight of 218.68 g/mol. Its IUPAC name is 1,3-dimethylnaphthalene-2-carbonyl chloride.
| Compound Name | 1,3-dimethylnaphthalene-2-carbonyl chloride |
|---|---|
| PubChem CID | 54124479 |
| Molecular Formula | C13H11ClO |
| Molecular Weight | 218.68 g/mol |
| Exact Mass | 218.05 |
| IUPAC Name | 1,3-dimethylnaphthalene-2-carbonyl chloride |
| SMILES | Cc1cc2ccccc2c(C)c1C(=O)Cl |
| InChI | InChI=1S/C13H11ClO/c1-8-7-10-5-3-4-6-11(10)9(2)12(8)13(14)15/h3-7H,1-2H3 |
| InChIKey | NPZOWEMFODNKOW-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.68 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|