C14H14O — CID 19884371
1-(2,3-dimethylnaphthalen-1-yl)ethanone (PubChem CID 19884371) has the molecular formula C14H14O and a molecular weight of 198.26 g/mol. Its IUPAC name is 1-(2,3-dimethylnaphthalen-1-yl)ethanone.
| Compound Name | 1-(2,3-dimethylnaphthalen-1-yl)ethanone |
|---|---|
| PubChem CID | 19884371 |
| Molecular Formula | C14H14O |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | 1-(2,3-dimethylnaphthalen-1-yl)ethanone |
| SMILES | CC(=O)c1c(C)c(C)cc2ccccc12 |
| InChI | InChI=1S/C14H14O/c1-9-8-12-6-4-5-7-13(12)14(10(9)2)11(3)15/h4-8H,1-3H3 |
| InChIKey | UDYAERDXMUUUAB-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |