C36H34O2 — CID 10255362
[1-anthracen-9-yl-2,2-bis(2,4,6-trimethylphenyl)ethenyl] acetate (PubChem CID 10255362) has the molecular formula C36H34O2 and a molecular weight of 498.67 g/mol. Its IUPAC name is [1-anthracen-9-yl-2,2-bis(2,4,6-trimethylphenyl)ethenyl] acetate.
| Compound Name | [1-anthracen-9-yl-2,2-bis(2,4,6-trimethylphenyl)ethenyl] acetate |
|---|---|
| PubChem CID | 10255362 |
| Molecular Formula | C36H34O2 |
| Molecular Weight | 498.67 g/mol |
| Exact Mass | 498.26 |
| IUPAC Name | [1-anthracen-9-yl-2,2-bis(2,4,6-trimethylphenyl)ethenyl] acetate |
| SMILES | CC(=O)OC(=C(c1c(C)cc(C)cc1C)c1c(C)cc(C)cc1C)c1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C36H34O2/c1-21-16-23(3)32(24(4)17-21)35(33-25(5)18-22(2)19-26(33)6)36(38-27(7)37)34-30-14-10-8-12-28(30)20-29-13-9-11-15-31(29)34/h8-20H,1-7H3 |
| InChIKey | LFWUIDDEPPDIGK-UHFFFAOYSA-N |
| XLogP | 9.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.67 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|