About 2-bromo-1-(2-methylnaphthalen-1-yl)ethanone;1-(2-methylnaphthalen-1-yl)ethanone;molecular bromine
2-bromo-1-(2-methylnaphthalen-1-yl)ethanone;1-(2-methylnaphthalen-1-yl)ethanone;molecular bromine (PubChem CID 162190058) has the molecular formula C26H23Br3O2
and a molecular weight of 607.18 g/mol. Its IUPAC name is 2-bromo-1-(2-methylnaphthalen-1-yl)ethanone;1-(2-methylnaphthalen-1-yl)ethanone;molecular bromine.
Molecular Properties
| Compound Name | 2-bromo-1-(2-methylnaphthalen-1-yl)ethanone;1-(2-methylnaphthalen-1-yl)ethanone;molecular bromine |
| PubChem CID | 162190058 |
| Molecular Formula | C26H23Br3O2 |
| Molecular Weight | 607.18 g/mol |
| Exact Mass | 603.92 |
| IUPAC Name | 2-bromo-1-(2-methylnaphthalen-1-yl)ethanone;1-(2-methylnaphthalen-1-yl)ethanone;molecular bromine |
| SMILES | BrBr.CC(=O)c1c(C)ccc2ccccc12.Cc1ccc2ccccc2c1C(=O)CBr |
| InChI | InChI=1S/C13H11BrO.C13H12O.Br2/c1-9-6-7-10-4-2-3-5-11(10)13(9)12(15)8-14;1-9-7-8-11-5-3-4-6-12(11)13(9)10(2)14;1-2/h2-7H,8H2,1H3;3-8H,1-2H3; |
| InChIKey | ZQEGWYJPHOHROO-UHFFFAOYSA-N |
| XLogP | 8.77 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 607.18 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-1-(2-methylnaphthalen-1-yl)ethanone;1-(2-methylnaphthalen-1-yl)ethanone;molecular bromine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-1-(2-methylnaphthalen-1-yl)ethanone;1-(2-methylnaphthalen-1-yl)ethanone;molecular bromine?
The IUPAC name of 2-bromo-1-(2-methylnaphthalen-1-yl)ethanone;1-(2-methylnaphthalen-1-yl)ethanone;molecular bromine (CID 162190058) is 2-bromo-1-(2-methylnaphthalen-1-yl)ethanone;1-(2-methylnaphthalen-1-yl)ethanone;molecular bromine.
What is the SMILES notation for 2-bromo-1-(2-methylnaphthalen-1-yl)ethanone;1-(2-methylnaphthalen-1-yl)ethanone;molecular bromine?
The canonical SMILES for 2-bromo-1-(2-methylnaphthalen-1-yl)ethanone;1-(2-methylnaphthalen-1-yl)ethanone;molecular bromine is BrBr.CC(=O)c1c(C)ccc2ccccc12.Cc1ccc2ccccc2c1C(=O)CBr.
What is the InChIKey of 2-bromo-1-(2-methylnaphthalen-1-yl)ethanone;1-(2-methylnaphthalen-1-yl)ethanone;molecular bromine?
The InChIKey is ZQEGWYJPHOHROO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11BrO.C13H12O.Br2/c1-9-6-7-10-4-2-3-5-11(10)13(9)12(15)8-14;1-9-7-8-11-5-3-4-6-12(11)13(9)10(2)14;1-2/h2-7H,8H2,1H3;3-8H,1-2H3;.
What are the key properties of 2-bromo-1-(2-methylnaphthalen-1-yl)ethanone;1-(2-methylnaphthalen-1-yl)ethanone;molecular bromine?
2-bromo-1-(2-methylnaphthalen-1-yl)ethanone;1-(2-methylnaphthalen-1-yl)ethanone;molecular bromine has a molecular weight of 607.18 g/mol, XLogP of 8.77, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-1-(2-methylnaphthalen-1-yl)ethanone;1-(2-methylnaphthalen-1-yl)ethanone;molecular bromine is sourced from PubChem (CID 162190058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).