C13H17NO3 — CID 141308124
5,6,7-trimethoxy-1,2-dimethylindole (PubChem CID 141308124) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is 5,6,7-trimethoxy-1,2-dimethylindole.
| Compound Name | 5,6,7-trimethoxy-1,2-dimethylindole |
|---|---|
| PubChem CID | 141308124 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 5,6,7-trimethoxy-1,2-dimethylindole |
| SMILES | COc1cc2cc(C)n(C)c2c(OC)c1OC |
| InChI | InChI=1S/C13H17NO3/c1-8-6-9-7-10(15-3)12(16-4)13(17-5)11(9)14(8)2/h6-7H,1-5H3 |
| InChIKey | BSAKWKOEWXHGKN-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 32.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |