C11H13NO — CID 82279889
7-methoxy-1,2-dimethylindole (PubChem CID 82279889) has the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. Its IUPAC name is 7-methoxy-1,2-dimethylindole.
| Compound Name | 7-methoxy-1,2-dimethylindole |
|---|---|
| PubChem CID | 82279889 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 7-methoxy-1,2-dimethylindole |
| SMILES | COc1cccc2cc(C)n(C)c12 |
| InChI | InChI=1S/C11H13NO/c1-8-7-9-5-4-6-10(13-3)11(9)12(8)2/h4-7H,1-3H3 |
| InChIKey | IHYPGXZKLINCFB-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |