C15H19NO3 — CID 43394694
2,5-dimethyl-1-(3,4,5-trimethoxyphenyl)pyrrole (PubChem CID 43394694) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is 2,5-dimethyl-1-(3,4,5-trimethoxyphenyl)pyrrole.
| Compound Name | 2,5-dimethyl-1-(3,4,5-trimethoxyphenyl)pyrrole |
|---|---|
| PubChem CID | 43394694 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | 2,5-dimethyl-1-(3,4,5-trimethoxyphenyl)pyrrole |
| SMILES | COc1cc(-n2c(C)ccc2C)cc(OC)c1OC |
| InChI | InChI=1S/C15H19NO3/c1-10-6-7-11(2)16(10)12-8-13(17-3)15(19-5)14(9-12)18-4/h6-9H,1-5H3 |
| InChIKey | XGJCYKHTLKZDQP-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 32.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|