C15H18O4 — CID 163473055
2,3,6,7-tetramethoxy-1-methylnaphthalene (PubChem CID 163473055) has the molecular formula C15H18O4 and a molecular weight of 262.31 g/mol. Its IUPAC name is 2,3,6,7-tetramethoxy-1-methylnaphthalene.
| Compound Name | 2,3,6,7-tetramethoxy-1-methylnaphthalene |
|---|---|
| PubChem CID | 163473055 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 2,3,6,7-tetramethoxy-1-methylnaphthalene |
| SMILES | COc1cc2cc(OC)c(OC)c(C)c2cc1OC |
| InChI | InChI=1S/C15H18O4/c1-9-11-8-13(17-3)12(16-2)6-10(11)7-14(18-4)15(9)19-5/h6-8H,1-5H3 |
| InChIKey | BYEBZUBEMDLQSX-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |