C16H16BrNO2 — CID 159315408
8,9-dimethoxy-7-methylbenzo[b]quinolizin-5-ium bromide (PubChem CID 159315408) has the molecular formula C16H16BrNO2 and a molecular weight of 334.21 g/mol. Its IUPAC name is 8,9-dimethoxy-7-methylbenzo[b]quinolizin-5-ium bromide.
| Compound Name | 8,9-dimethoxy-7-methylbenzo[b]quinolizin-5-ium bromide |
|---|---|
| PubChem CID | 159315408 |
| Molecular Formula | C16H16BrNO2 |
| Molecular Weight | 334.21 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | 8,9-dimethoxy-7-methylbenzo[b]quinolizin-5-ium bromide |
| SMILES | COc1cc2cc3cccc[n+]3cc2c(C)c1OC.[Br-] |
| InChI | InChI=1S/C16H16NO2.BrH/c1-11-14-10-17-7-5-4-6-13(17)8-12(14)9-15(18-2)16(11)19-3;/h4-10H,1-3H3;1H/q+1;/p-1 |
| InChIKey | LDBMMKBOPPXMHL-UHFFFAOYSA-M |
| XLogP | -0.09 |
| TPSA | 22.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.21 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|