C13H10BrNO3 — CID 157337044
benzo[b]quinolizin-5-ium-8,9,10-triol bromide (PubChem CID 157337044) has the molecular formula C13H10BrNO3 and a molecular weight of 308.13 g/mol. Its IUPAC name is benzo[b]quinolizin-5-ium-8,9,10-triol bromide.
| Compound Name | benzo[b]quinolizin-5-ium-8,9,10-triol bromide |
|---|---|
| PubChem CID | 157337044 |
| Molecular Formula | C13H10BrNO3 |
| Molecular Weight | 308.13 g/mol |
| Exact Mass | 306.98 |
| IUPAC Name | benzo[b]quinolizin-5-ium-8,9,10-triol bromide |
| SMILES | Oc1cc2c[n+]3ccccc3cc2c(O)c1O.[Br-] |
| InChI | InChI=1S/C13H9NO3.BrH/c15-11-5-8-7-14-4-2-1-3-9(14)6-10(8)12(16)13(11)17;/h1-7,15-16H;1H |
| InChIKey | BFYKQUZYGBFXBB-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.13 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'het_pyridiniums_B(2)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|