C20H14IN2+ — CID 54611068
4,21-diazoniapentacyclo[12.8.0.02,11.04,9.016,21]docosa-1(22),2,4,6,8,10,12,14,16,18,20-undecaene iodide (PubChem CID 54611068) has the molecular formula C20H14IN2+ and a molecular weight of 409.25 g/mol. Its IUPAC name is 4,21-diazoniapentacyclo[12.8.0.02,11.04,9.016,21]docosa-1(22),2,4,6,8,10,12,14,16,18,20-undecaene iodide.
| Compound Name | 4,21-diazoniapentacyclo[12.8.0.02,11.04,9.016,21]docosa-1(22),2,4,6,8,10,12,14,16,18,20-undecaene iodide |
|---|---|
| PubChem CID | 54611068 |
| Molecular Formula | C20H14IN2+ |
| Molecular Weight | 409.25 g/mol |
| Exact Mass | 409.02 |
| IUPAC Name | 4,21-diazoniapentacyclo[12.8.0.02,11.04,9.016,21]docosa-1(22),2,4,6,8,10,12,14,16,18,20-undecaene iodide |
| SMILES | [I-].c1cc[n+]2cc3c(ccc4cc5cccc[n+]5cc43)cc2c1 |
| InChI | InChI=1S/C20H14N2.HI/c1-3-9-21-13-19-15(11-17(21)5-1)7-8-16-12-18-6-2-4-10-22(18)14-20(16)19;/h1-14H;1H/q+2;/p-1 |
| InChIKey | KSAQGAPMIODXEN-UHFFFAOYSA-M |
| XLogP | 0.47 |
| TPSA | 8.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.25 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_B(2)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|