C22H18B2F8N2 — CID 11533154
3,13-dimethyl-9,16-diazoniapentacyclo[12.8.0.02,11.04,9.016,21]docosa-1(22),2,4,6,8,10,12,14,16,18,20-undecaene ditetrafluoroborate (PubChem CID 11533154) has the molecular formula C22H18B2F8N2 and a molecular weight of 484.01 g/mol. Its IUPAC name is 3,13-dimethyl-9,16-diazoniapentacyclo[12.8.0.02,11.04,9.016,21]docosa-1(22),2,4,6,8,10,12,14,16,18,20-undecaene ditetrafluoroborate.
| Compound Name | 3,13-dimethyl-9,16-diazoniapentacyclo[12.8.0.02,11.04,9.016,21]docosa-1(22),2,4,6,8,10,12,14,16,18,20-undecaene ditetrafluoroborate |
|---|---|
| PubChem CID | 11533154 |
| Molecular Formula | C22H18B2F8N2 |
| Molecular Weight | 484.01 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | 3,13-dimethyl-9,16-diazoniapentacyclo[12.8.0.02,11.04,9.016,21]docosa-1(22),2,4,6,8,10,12,14,16,18,20-undecaene ditetrafluoroborate |
| SMILES | Cc1cc2c[n+]3ccccc3c(C)c2c2cc3cccc[n+]3cc12.F[B-](F)(F)F.F[B-](F)(F)F |
| InChI | InChI=1S/C22H18N2.2BF4/c1-15-11-17-13-24-10-6-4-8-21(24)16(2)22(17)19-12-18-7-3-5-9-23(18)14-20(15)19;2*2-1(3,4)5/h3-14H,1-2H3;;/q+2;2*-1 |
| InChIKey | ACWWQQJNVQMTPY-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 8.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.01 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_B(2)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|