C19H14BrNO2 — CID 160867813
10-phenylbenzo[b]quinolizin-5-ium-7,8-diol bromide (PubChem CID 160867813) has the molecular formula C19H14BrNO2 and a molecular weight of 368.23 g/mol. Its IUPAC name is 10-phenylbenzo[b]quinolizin-5-ium-7,8-diol bromide.
| Compound Name | 10-phenylbenzo[b]quinolizin-5-ium-7,8-diol bromide |
|---|---|
| PubChem CID | 160867813 |
| Molecular Formula | C19H14BrNO2 |
| Molecular Weight | 368.23 g/mol |
| Exact Mass | 367.02 |
| IUPAC Name | 10-phenylbenzo[b]quinolizin-5-ium-7,8-diol bromide |
| SMILES | Oc1cc(-c2ccccc2)c2cc3cccc[n+]3cc2c1O.[Br-] |
| InChI | InChI=1S/C19H13NO2.BrH/c21-18-11-15(13-6-2-1-3-7-13)16-10-14-8-4-5-9-20(14)12-17(16)19(18)22;/h1-12,21H;1H |
| InChIKey | SLIZUAXPABCTGJ-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 44.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.23 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'het_pyridiniums_B(2)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|