C36H26O3 — CID 176656433
4-(4-hydroxy-2,6-diphenylphenoxy)-3,5-diphenylphenol (PubChem CID 176656433) has the molecular formula C36H26O3 and a molecular weight of 506.60 g/mol. Its IUPAC name is 4-(4-hydroxy-2,6-diphenylphenoxy)-3,5-diphenylphenol.
| Compound Name | 4-(4-hydroxy-2,6-diphenylphenoxy)-3,5-diphenylphenol |
|---|---|
| PubChem CID | 176656433 |
| Molecular Formula | C36H26O3 |
| Molecular Weight | 506.60 g/mol |
| Exact Mass | 506.19 |
| IUPAC Name | 4-(4-hydroxy-2,6-diphenylphenoxy)-3,5-diphenylphenol |
| SMILES | Oc1cc(-c2ccccc2)c(Oc2c(-c3ccccc3)cc(O)cc2-c2ccccc2)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C36H26O3/c37-29-21-31(25-13-5-1-6-14-25)35(32(22-29)26-15-7-2-8-16-26)39-36-33(27-17-9-3-10-18-27)23-30(38)24-34(36)28-19-11-4-12-20-28/h1-24,37-38H |
| InChIKey | CDKTYEDMWPLGFV-UHFFFAOYSA-N |
| XLogP | 9.56 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.60 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |