C21H13N2O2+ — CID 102007402
2-benzo[b]quinolizin-5-ium-9-ylisoindole-1,3-dione (PubChem CID 102007402) has the molecular formula C21H13N2O2+ and a molecular weight of 325.35 g/mol. Its IUPAC name is 2-benzo[b]quinolizin-5-ium-9-ylisoindole-1,3-dione.
| Compound Name | 2-benzo[b]quinolizin-5-ium-9-ylisoindole-1,3-dione |
|---|---|
| PubChem CID | 102007402 |
| Molecular Formula | C21H13N2O2+ |
| Molecular Weight | 325.35 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 2-benzo[b]quinolizin-5-ium-9-ylisoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1c1ccc2c[n+]3ccccc3cc2c1 |
| InChI | InChI=1S/C21H13N2O2/c24-20-18-6-1-2-7-19(18)21(25)23(20)17-9-8-14-13-22-10-4-3-5-16(22)11-15(14)12-17/h1-13H/q+1 |
| InChIKey | BXVRABCGFUXRAY-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 41.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.35 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_B(2)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|