C18H9NO8S2-2 — CID 168517075
6-(1,3-dioxoisoindol-2-yl)naphthalene-1,3-disulfonate (PubChem CID 168517075) has the molecular formula C18H9NO8S2-2 and a molecular weight of 431.40 g/mol. Its IUPAC name is 6-(1,3-dioxoisoindol-2-yl)naphthalene-1,3-disulfonate.
| Compound Name | 6-(1,3-dioxoisoindol-2-yl)naphthalene-1,3-disulfonate |
|---|---|
| PubChem CID | 168517075 |
| Molecular Formula | C18H9NO8S2-2 |
| Molecular Weight | 431.40 g/mol |
| Exact Mass | 430.98 |
| IUPAC Name | 6-(1,3-dioxoisoindol-2-yl)naphthalene-1,3-disulfonate |
| SMILES | O=C1c2ccccc2C(=O)N1c1ccc2c(S(=O)(=O)[O-])cc(S(=O)(=O)[O-])cc2c1 |
| InChI | InChI=1S/C18H11NO8S2/c20-17-14-3-1-2-4-15(14)18(21)19(17)11-5-6-13-10(7-11)8-12(28(22,23)24)9-16(13)29(25,26)27/h1-9H,(H,22,23,24)(H,25,26,27)/p-2 |
| InChIKey | DTZNXQFGKPQVFB-UHFFFAOYSA-L |
| XLogP | 1.45 |
| TPSA | 151.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.40 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|