C22H13N3O6S — CID 137429251
2,5-bis(1,3-dioxoisoindol-2-yl)benzenesulfonamide (PubChem CID 137429251) has the molecular formula C22H13N3O6S and a molecular weight of 447.43 g/mol. Its IUPAC name is 2,5-bis(1,3-dioxoisoindol-2-yl)benzenesulfonamide.
| Compound Name | 2,5-bis(1,3-dioxoisoindol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 137429251 |
| Molecular Formula | C22H13N3O6S |
| Molecular Weight | 447.43 g/mol |
| Exact Mass | 447.05 |
| IUPAC Name | 2,5-bis(1,3-dioxoisoindol-2-yl)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cc(N2C(=O)c3ccccc3C2=O)ccc1N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C22H13N3O6S/c23-32(30,31)18-11-12(24-19(26)13-5-1-2-6-14(13)20(24)27)9-10-17(18)25-21(28)15-7-3-4-8-16(15)22(25)29/h1-11H,(H2,23,30,31) |
| InChIKey | NDUNUGLELSYKDI-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 134.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.43 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|